C23H23ClF2IN3O4S — CID 154991061
(2R,4R,5R)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-iodo-5-methyl-1-(3-sulfamoylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 154991061) has the molecular formula C23H23ClF2IN3O4S and a molecular weight of 637.87 g/mol. Its IUPAC name is (2R,4R,5R)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-iodo-5-methyl-1-(3-sulfamoylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R,5R)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-iodo-5-methyl-1-(3-sulfamoylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154991061 |
| Molecular Formula | C23H23ClF2IN3O4S |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 637.01 |
| IUPAC Name | (2R,4R,5R)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-4-iodo-5-methyl-1-(3-sulfamoylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1[C@H](I)C[C@H](C(=O)N[C@@H](c2cc(F)c(Cl)cc2F)C2CC2)N1C(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C23H23ClF2IN3O4S/c1-11-19(27)10-20(30(11)23(32)13-3-2-4-14(7-13)35(28,33)34)22(31)29-21(12-5-6-12)15-8-18(26)16(24)9-17(15)25/h2-4,7-9,11-12,19-21H,5-6,10H2,1H3,(H,29,31)(H2,28,33,34)/t11-,19-,20-,21-/m1/s1 |
| InChIKey | NORFHPVBDBIADI-JEWSRIHYSA-N |
| XLogP | 3.94 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|