C24H20ClF2N3O2 — CID 163664322
(1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-2-(2-methylpyridine-4-carbonyl)-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide (PubChem CID 163664322) has the molecular formula C24H20ClF2N3O2 and a molecular weight of 455.89 g/mol. Its IUPAC name is (1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-2-(2-methylpyridine-4-carbonyl)-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide.
| Compound Name | (1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-2-(2-methylpyridine-4-carbonyl)-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide |
|---|---|
| PubChem CID | 163664322 |
| Molecular Formula | C24H20ClF2N3O2 |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (1S,3R,5S)-N-[(R)-(4-chloro-2,5-difluorophenyl)-cyclopropylmethyl]-2-(2-methylpyridine-4-carbonyl)-2-azabicyclo[3.2.0]hept-6-yne-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2[C@@H](C(=O)N[C@@H](c3cc(F)c(Cl)cc3F)C3CC3)C[C@H]3C#C[C@H]32)ccn1 |
| InChI | InChI=1S/C24H20ClF2N3O2/c1-12-8-15(6-7-28-12)24(32)30-20-5-4-14(20)9-21(30)23(31)29-22(13-2-3-13)16-10-19(27)17(25)11-18(16)26/h6-8,10-11,13-14,20-22H,2-3,9H2,1H3,(H,29,31)/t14-,20-,21-,22-/m1/s1 |
| InChIKey | IXBYDXRKKLHFCX-ISQWPPNESA-N |
| XLogP | 3.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|