C9H12ClN3O2 — CID 138472162
5-chloro-4-(4-oxopiperidin-1-yl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 138472162) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is 5-chloro-4-(4-oxopiperidin-1-yl)-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-(4-oxopiperidin-1-yl)-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 138472162 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 5-chloro-4-(4-oxopiperidin-1-yl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCN(C2C=NNC(=O)C2Cl)CC1 |
| InChI | InChI=1S/C9H12ClN3O2/c10-8-7(5-11-12-9(8)15)13-3-1-6(14)2-4-13/h5,7-8H,1-4H2,(H,12,15) |
| InChIKey | JZSUXVJRXFUCCA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|