C24H26F3NO3 — CID 138473824
[3-methoxy-4-(3,3,3-trifluoropropoxymethyl)phenyl]-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone (PubChem CID 138473824) has the molecular formula C24H26F3NO3 and a molecular weight of 433.47 g/mol. Its IUPAC name is [3-methoxy-4-(3,3,3-trifluoropropoxymethyl)phenyl]-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone.
| Compound Name | [3-methoxy-4-(3,3,3-trifluoropropoxymethyl)phenyl]-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone |
|---|---|
| PubChem CID | 138473824 |
| Molecular Formula | C24H26F3NO3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [3-methoxy-4-(3,3,3-trifluoropropoxymethyl)phenyl]-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCC3(c4ccccc4)CC2C3)ccc1COCCC(F)(F)F |
| InChI | InChI=1S/C24H26F3NO3/c1-30-21-13-17(7-8-18(21)16-31-12-10-24(25,26)27)22(29)28-11-9-23(14-20(28)15-23)19-5-3-2-4-6-19/h2-8,13,20H,9-12,14-16H2,1H3 |
| InChIKey | OMHYUJXJVXBJEM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|