C23H27NO2 — CID 138473876
(3-methyl-4-propan-2-yloxyphenyl)-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone (PubChem CID 138473876) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (3-methyl-4-propan-2-yloxyphenyl)-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone.
| Compound Name | (3-methyl-4-propan-2-yloxyphenyl)-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone |
|---|---|
| PubChem CID | 138473876 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (3-methyl-4-propan-2-yloxyphenyl)-(5-phenyl-2-azabicyclo[3.1.1]heptan-2-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC3(c4ccccc4)CC2C3)ccc1OC(C)C |
| InChI | InChI=1S/C23H27NO2/c1-16(2)26-21-10-9-18(13-17(21)3)22(25)24-12-11-23(14-20(24)15-23)19-7-5-4-6-8-19/h4-10,13,16,20H,11-12,14-15H2,1-3H3 |
| InChIKey | DTGMPFUUFXGZSK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |