C22H24FNO2 — CID 87055926
(3-fluoro-4-propan-2-yloxyphenyl)-(6-phenyl-3-azabicyclo[4.1.0]heptan-3-yl)methanone (PubChem CID 87055926) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is (3-fluoro-4-propan-2-yloxyphenyl)-(6-phenyl-3-azabicyclo[4.1.0]heptan-3-yl)methanone.
| Compound Name | (3-fluoro-4-propan-2-yloxyphenyl)-(6-phenyl-3-azabicyclo[4.1.0]heptan-3-yl)methanone |
|---|---|
| PubChem CID | 87055926 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3-fluoro-4-propan-2-yloxyphenyl)-(6-phenyl-3-azabicyclo[4.1.0]heptan-3-yl)methanone |
| SMILES | CC(C)Oc1ccc(C(=O)N2CCC3(c4ccccc4)CC3C2)cc1F |
| InChI | InChI=1S/C22H24FNO2/c1-15(2)26-20-9-8-16(12-19(20)23)21(25)24-11-10-22(13-18(22)14-24)17-6-4-3-5-7-17/h3-9,12,15,18H,10-11,13-14H2,1-2H3 |
| InChIKey | XKGCUVLTMPFELM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |