C10H18F2O3 — CID 138478690
(2R,3R)-8,9-difluoro-3-hydroxy-2-methylnonanoic acid (PubChem CID 138478690) has the molecular formula C10H18F2O3 and a molecular weight of 224.25 g/mol. Its IUPAC name is (2R,3R)-8,9-difluoro-3-hydroxy-2-methylnonanoic acid.
| Compound Name | (2R,3R)-8,9-difluoro-3-hydroxy-2-methylnonanoic acid |
|---|---|
| PubChem CID | 138478690 |
| Molecular Formula | C10H18F2O3 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2R,3R)-8,9-difluoro-3-hydroxy-2-methylnonanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@H](O)CCCCC(F)CF |
| InChI | InChI=1S/C10H18F2O3/c1-7(10(14)15)9(13)5-3-2-4-8(12)6-11/h7-9,13H,2-6H2,1H3,(H,14,15)/t7-,8?,9-/m1/s1 |
| InChIKey | QWCHWPCJCNDYOZ-PSGOWDBMSA-N |
| XLogP | 1.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|