3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid

C18H32O3 — CID 163153417

IUPAC3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid
SMILESCC=C(C)C=C(C)CC(C)CCCCC(O)C(C)C(=O)O
InChIInChI=1S/C18H32O3/c1-6-13(2)11-15(4)12-14(3)9-7-8-10-17(19)16(5)18(20)21/h6,11,14,16-17,19H,7-10,12H2,1-5H3,(H,20,21)
InChIKeyOFEICKOWYHYGFA-UHFFFAOYSA-N
MW296.45 g/mol
LogP4.57
Rot. Bonds10

About 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid

3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid (PubChem CID 163153417) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid.

Molecular Properties

Compound Name3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid
PubChem CID163153417
Molecular FormulaC18H32O3
Molecular Weight296.45 g/mol
Exact Mass296.24
IUPAC Name3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid
SMILESCC=C(C)C=C(C)CC(C)CCCCC(O)C(C)C(=O)O
InChIInChI=1S/C18H32O3/c1-6-13(2)11-15(4)12-14(3)9-7-8-10-17(19)16(5)18(20)21/h6,11,14,16-17,19H,7-10,12H2,1-5H3,(H,20,21)
InChIKeyOFEICKOWYHYGFA-UHFFFAOYSA-N
XLogP4.57
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.45
LogP ≤ 54.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid?
The IUPAC name of 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid (CID 163153417) is 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid.
What is the SMILES notation for 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid?
The canonical SMILES for 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid is CC=C(C)C=C(C)CC(C)CCCCC(O)C(C)C(=O)O.
What is the InChIKey of 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid?
The InChIKey is OFEICKOWYHYGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O3/c1-6-13(2)11-15(4)12-14(3)9-7-8-10-17(19)16(5)18(20)21/h6,11,14,16-17,19H,7-10,12H2,1-5H3,(H,20,21).
What are the key properties of 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid?
3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid has a molecular weight of 296.45 g/mol, XLogP of 4.57, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,8,10,12-tetramethyltetradeca-10,12-dienoic acid is sourced from PubChem (CID 163153417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).