C23H26F4N2O7 — CID 138480158
(3S)-3-[(1-cyclopentyloxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480158) has the molecular formula C23H26F4N2O7 and a molecular weight of 518.46 g/mol. Its IUPAC name is (3S)-3-[(1-cyclopentyloxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[(1-cyclopentyloxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480158 |
| Molecular Formula | C23H26F4N2O7 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | (3S)-3-[(1-cyclopentyloxycarbonylpiperidine-4-carbonyl)amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CCN(C(=O)OC2CCCC2)CC1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C23H26F4N2O7/c24-14-9-15(25)20(27)21(19(14)26)35-11-17(30)16(10-18(31)32)28-22(33)12-5-7-29(8-6-12)23(34)36-13-3-1-2-4-13/h9,12-13,16H,1-8,10-11H2,(H,28,33)(H,31,32)/t16-/m0/s1 |
| InChIKey | KCANTMNBUCMBQM-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|