C28H30F4N2O7 — CID 138480076
(3S)-3-[[1-(2-tert-butylphenoxy)carbonylpiperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480076) has the molecular formula C28H30F4N2O7 and a molecular weight of 582.55 g/mol. Its IUPAC name is (3S)-3-[[1-(2-tert-butylphenoxy)carbonylpiperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[1-(2-tert-butylphenoxy)carbonylpiperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480076 |
| Molecular Formula | C28H30F4N2O7 |
| Molecular Weight | 582.55 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | (3S)-3-[[1-(2-tert-butylphenoxy)carbonylpiperidine-4-carbonyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)(C)c1ccccc1OC(=O)N1CCC(C(=O)N[C@@H](CC(=O)O)C(=O)COc2c(F)c(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C28H30F4N2O7/c1-28(2,3)16-6-4-5-7-21(16)41-27(39)34-10-8-15(9-11-34)26(38)33-19(13-22(36)37)20(35)14-40-25-23(31)17(29)12-18(30)24(25)32/h4-7,12,15,19H,8-11,13-14H2,1-3H3,(H,33,38)(H,36,37)/t19-/m0/s1 |
| InChIKey | CJGYCEPXRSVKOI-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|