C17H31N — CID 138480386
(Z)-3,6-dimethylidenepentadec-11-en-2-amine (PubChem CID 138480386) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (Z)-3,6-dimethylidenepentadec-11-en-2-amine.
| Compound Name | (Z)-3,6-dimethylidenepentadec-11-en-2-amine |
|---|---|
| PubChem CID | 138480386 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (Z)-3,6-dimethylidenepentadec-11-en-2-amine |
| SMILES | C=C(CCCC/C=C\CCC)CCC(=C)C(C)N |
| InChI | InChI=1S/C17H31N/c1-5-6-7-8-9-10-11-12-15(2)13-14-16(3)17(4)18/h7-8,17H,2-3,5-6,9-14,18H2,1,4H3/b8-7- |
| InChIKey | JVSNJENWTMHLRG-FPLPWBNLSA-N |
| XLogP | 5.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|