C25H44O — CID 143578892
(6E)-12-methylidene-4-prop-1-en-2-ylhenicosa-1,6-dien-2-ol (PubChem CID 143578892) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is (6E)-12-methylidene-4-prop-1-en-2-ylhenicosa-1,6-dien-2-ol.
| Compound Name | (6E)-12-methylidene-4-prop-1-en-2-ylhenicosa-1,6-dien-2-ol |
|---|---|
| PubChem CID | 143578892 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | (6E)-12-methylidene-4-prop-1-en-2-ylhenicosa-1,6-dien-2-ol |
| SMILES | C=C(O)CC(C/C=C/CCCCC(=C)CCCCCCCCC)C(=C)C |
| InChI | InChI=1S/C25H44O/c1-6-7-8-9-10-12-15-18-23(4)19-16-13-11-14-17-20-25(22(2)3)21-24(5)26/h14,17,25-26H,2,4-13,15-16,18-21H2,1,3H3/b17-14+ |
| InChIKey | NDKOXGBUSGCJDI-SAPNQHFASA-N |
| XLogP | 8.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|