C17H22BrN5O2 — CID 138484435
tert-butyl 1-[1-(2-bromo-3-pyridinyl)ethyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylate (PubChem CID 138484435) has the molecular formula C17H22BrN5O2 and a molecular weight of 408.30 g/mol. Its IUPAC name is tert-butyl 1-[1-(2-bromo-3-pyridinyl)ethyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 1-[1-(2-bromo-3-pyridinyl)ethyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 138484435 |
| Molecular Formula | C17H22BrN5O2 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | tert-butyl 1-[1-(2-bromo-3-pyridinyl)ethyl]-6,7-dihydro-4H-triazolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC(c1cccnc1Br)n1nnc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C17H22BrN5O2/c1-11(12-6-5-8-19-15(12)18)23-14-7-9-22(10-13(14)20-21-23)16(24)25-17(2,3)4/h5-6,8,11H,7,9-10H2,1-4H3 |
| InChIKey | OBJMBENDXKRRJD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|