C12H13Cl2FO — CID 138485152
1,3-dichloro-5-[(3-fluorocyclopentyl)methoxy]benzene (PubChem CID 138485152) has the molecular formula C12H13Cl2FO and a molecular weight of 263.14 g/mol. Its IUPAC name is 1,3-dichloro-5-[(3-fluorocyclopentyl)methoxy]benzene.
| Compound Name | 1,3-dichloro-5-[(3-fluorocyclopentyl)methoxy]benzene |
|---|---|
| PubChem CID | 138485152 |
| Molecular Formula | C12H13Cl2FO |
| Molecular Weight | 263.14 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1,3-dichloro-5-[(3-fluorocyclopentyl)methoxy]benzene |
| SMILES | FC1CCC(COc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C12H13Cl2FO/c13-9-4-10(14)6-12(5-9)16-7-8-1-2-11(15)3-8/h4-6,8,11H,1-3,7H2 |
| InChIKey | VMCURWICCCLWOI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.14 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |