C12H13ClO2 — CID 84689444
1-[3-chloro-5-(cyclopropylmethoxy)phenyl]ethanone (PubChem CID 84689444) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-[3-chloro-5-(cyclopropylmethoxy)phenyl]ethanone.
| Compound Name | 1-[3-chloro-5-(cyclopropylmethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 84689444 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-[3-chloro-5-(cyclopropylmethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(Cl)cc(OCC2CC2)c1 |
| InChI | InChI=1S/C12H13ClO2/c1-8(14)10-4-11(13)6-12(5-10)15-7-9-2-3-9/h4-6,9H,2-3,7H2,1H3 |
| InChIKey | UEISZKRNNVHJGH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |