C13H16Cl2O2 — CID 143728042
[3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol (PubChem CID 143728042) has the molecular formula C13H16Cl2O2 and a molecular weight of 275.17 g/mol. Its IUPAC name is [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol.
| Compound Name | [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 143728042 |
| Molecular Formula | C13H16Cl2O2 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [3-chloro-5-[(3-chlorocyclopentyl)methoxy]phenyl]methanol |
| SMILES | OCc1cc(Cl)cc(OCC2CCC(Cl)C2)c1 |
| InChI | InChI=1S/C13H16Cl2O2/c14-11-2-1-9(3-11)8-17-13-5-10(7-16)4-12(15)6-13/h4-6,9,11,16H,1-3,7-8H2 |
| InChIKey | YNMWRFKGRXTZLW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|