C17H14N4O2 — CID 138486509
4-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]benzonitrile (PubChem CID 138486509) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]benzonitrile.
| Compound Name | 4-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 138486509 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCOc2cccc(-n3cnnc3)c2)cc1 |
| InChI | InChI=1S/C17H14N4O2/c18-11-14-4-6-16(7-5-14)22-8-9-23-17-3-1-2-15(10-17)21-12-19-20-13-21/h1-7,10,12-13H,8-9H2 |
| InChIKey | GHPLDLHQOOZLBD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|