C11H11N3O — CID 91684259
4-(3-prop-2-enoxyphenyl)-1,2,4-triazole (PubChem CID 91684259) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-(3-prop-2-enoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-(3-prop-2-enoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 91684259 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 4-(3-prop-2-enoxyphenyl)-1,2,4-triazole |
| SMILES | C=CCOc1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C11H11N3O/c1-2-6-15-11-5-3-4-10(7-11)14-8-12-13-9-14/h2-5,7-9H,1,6H2 |
| InChIKey | BZBGUODXQMHRJI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|