C18H16N6O2 — CID 102112326
4-[3-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]phenyl]-1,2,4-triazole (PubChem CID 102112326) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-[3-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]phenyl]-1,2,4-triazole.
| Compound Name | 4-[3-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 102112326 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-[3-[2-[3-(1,2,4-triazol-4-yl)phenoxy]ethoxy]phenyl]-1,2,4-triazole |
| SMILES | c1cc(OCCOc2cccc(-n3cnnc3)c2)cc(-n2cnnc2)c1 |
| InChI | InChI=1S/C18H16N6O2/c1-3-15(23-11-19-20-12-23)9-17(5-1)25-7-8-26-18-6-2-4-16(10-18)24-13-21-22-14-24/h1-6,9-14H,7-8H2 |
| InChIKey | XUAPKGQATKFMHT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|