C12H16N4O — CID 96687117
2-[3-(3-ethyl-1,2,4-triazol-4-yl)phenoxy]ethanamine (PubChem CID 96687117) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-[3-(3-ethyl-1,2,4-triazol-4-yl)phenoxy]ethanamine.
| Compound Name | 2-[3-(3-ethyl-1,2,4-triazol-4-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 96687117 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-[3-(3-ethyl-1,2,4-triazol-4-yl)phenoxy]ethanamine |
| SMILES | CCc1nncn1-c1cccc(OCCN)c1 |
| InChI | InChI=1S/C12H16N4O/c1-2-12-15-14-9-16(12)10-4-3-5-11(8-10)17-7-6-13/h3-5,8-9H,2,6-7,13H2,1H3 |
| InChIKey | BCVJRNVWQXOWIO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |