C10H12N4O — CID 84672362
3-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]phenol (PubChem CID 84672362) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]phenol.
| Compound Name | 3-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]phenol |
|---|---|
| PubChem CID | 84672362 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]phenol |
| SMILES | NCCc1nncn1-c1cccc(O)c1 |
| InChI | InChI=1S/C10H12N4O/c11-5-4-10-13-12-7-14(10)8-2-1-3-9(15)6-8/h1-3,6-7,15H,4-5,11H2 |
| InChIKey | XJFABEICSWIQDZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |