C14H21N5 — CID 98016995
4-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]-N,N-diethylaniline (PubChem CID 98016995) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 4-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]-N,N-diethylaniline.
| Compound Name | 4-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 98016995 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-[3-(2-aminoethyl)-1,2,4-triazol-4-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-n2cnnc2CCN)cc1 |
| InChI | InChI=1S/C14H21N5/c1-3-18(4-2)12-5-7-13(8-6-12)19-11-16-17-14(19)9-10-15/h5-8,11H,3-4,9-10,15H2,1-2H3 |
| InChIKey | XESZKFPSNXEVLM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|