C11H12ClN3O — CID 56718171
3-[4-(4-chlorophenyl)-1,2,4-triazol-3-yl]propan-1-ol (PubChem CID 56718171) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-1,2,4-triazol-3-yl]propan-1-ol.
| Compound Name | 3-[4-(4-chlorophenyl)-1,2,4-triazol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 56718171 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-1,2,4-triazol-3-yl]propan-1-ol |
| SMILES | OCCCc1nncn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3O/c12-9-3-5-10(6-4-9)15-8-13-14-11(15)2-1-7-16/h3-6,8,16H,1-2,7H2 |
| InChIKey | PYRLZCLOAZMQOJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |