C19H15F2IN2O3 — CID 138487436
4-(2,6-difluoro-4-iodophenoxy)-2-[(4-methoxyphenyl)methyl]-6-methylpyridazin-3-one (PubChem CID 138487436) has the molecular formula C19H15F2IN2O3 and a molecular weight of 484.24 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-iodophenoxy)-2-[(4-methoxyphenyl)methyl]-6-methylpyridazin-3-one.
| Compound Name | 4-(2,6-difluoro-4-iodophenoxy)-2-[(4-methoxyphenyl)methyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 138487436 |
| Molecular Formula | C19H15F2IN2O3 |
| Molecular Weight | 484.24 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 4-(2,6-difluoro-4-iodophenoxy)-2-[(4-methoxyphenyl)methyl]-6-methylpyridazin-3-one |
| SMILES | COc1ccc(Cn2nc(C)cc(Oc3c(F)cc(I)cc3F)c2=O)cc1 |
| InChI | InChI=1S/C19H15F2IN2O3/c1-11-7-17(27-18-15(20)8-13(22)9-16(18)21)19(25)24(23-11)10-12-3-5-14(26-2)6-4-12/h3-9H,10H2,1-2H3 |
| InChIKey | QKKZRRRTSJGMFL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|