C17H12BrF3N2O3 — CID 162731856
6-bromo-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethoxy)phthalazin-1-one (PubChem CID 162731856) has the molecular formula C17H12BrF3N2O3 and a molecular weight of 429.19 g/mol. Its IUPAC name is 6-bromo-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethoxy)phthalazin-1-one.
| Compound Name | 6-bromo-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethoxy)phthalazin-1-one |
|---|---|
| PubChem CID | 162731856 |
| Molecular Formula | C17H12BrF3N2O3 |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 6-bromo-2-[(4-methoxyphenyl)methyl]-4-(trifluoromethoxy)phthalazin-1-one |
| SMILES | COc1ccc(Cn2nc(OC(F)(F)F)c3cc(Br)ccc3c2=O)cc1 |
| InChI | InChI=1S/C17H12BrF3N2O3/c1-25-12-5-2-10(3-6-12)9-23-16(24)13-7-4-11(18)8-14(13)15(22-23)26-17(19,20)21/h2-8H,9H2,1H3 |
| InChIKey | KVSDAUZLSQVWPK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |