C14H15BrN2O5S — CID 86715219
2-[5-bromo-1-[(4-methoxyphenyl)methyl]-6-oxopyridazin-3-yl]ethanesulfonic acid (PubChem CID 86715219) has the molecular formula C14H15BrN2O5S and a molecular weight of 403.25 g/mol. Its IUPAC name is 2-[5-bromo-1-[(4-methoxyphenyl)methyl]-6-oxopyridazin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[5-bromo-1-[(4-methoxyphenyl)methyl]-6-oxopyridazin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 86715219 |
| Molecular Formula | C14H15BrN2O5S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 2-[5-bromo-1-[(4-methoxyphenyl)methyl]-6-oxopyridazin-3-yl]ethanesulfonic acid |
| SMILES | COc1ccc(Cn2nc(CCS(=O)(=O)O)cc(Br)c2=O)cc1 |
| InChI | InChI=1S/C14H15BrN2O5S/c1-22-12-4-2-10(3-5-12)9-17-14(18)13(15)8-11(16-17)6-7-23(19,20)21/h2-5,8H,6-7,9H2,1H3,(H,19,20,21) |
| InChIKey | WXRJRKICZZVQQA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|