C16H18ClN3O3 — CID 168896480
4-amino-6-chloro-5-[(E)-2-ethoxyethenyl]-2-[(4-methoxyphenyl)methyl]pyridazin-3-one (PubChem CID 168896480) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 4-amino-6-chloro-5-[(E)-2-ethoxyethenyl]-2-[(4-methoxyphenyl)methyl]pyridazin-3-one.
| Compound Name | 4-amino-6-chloro-5-[(E)-2-ethoxyethenyl]-2-[(4-methoxyphenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 168896480 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-amino-6-chloro-5-[(E)-2-ethoxyethenyl]-2-[(4-methoxyphenyl)methyl]pyridazin-3-one |
| SMILES | CCO/C=C/c1c(Cl)nn(Cc2ccc(OC)cc2)c(=O)c1N |
| InChI | InChI=1S/C16H18ClN3O3/c1-3-23-9-8-13-14(18)16(21)20(19-15(13)17)10-11-4-6-12(22-2)7-5-11/h4-9H,3,10,18H2,1-2H3/b9-8+ |
| InChIKey | WAVRYKSNCXNLRO-CMDGGOBGSA-N |
| XLogP | 2.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|