C49H37NS — CID 138488724
2-[(1Z)-buta-1,3-dienyl]-3-methyl-N,N-bis[4-(3-phenylphenyl)phenyl]-1-benzothiophen-5-amine (PubChem CID 138488724) has the molecular formula C49H37NS and a molecular weight of 671.91 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3-methyl-N,N-bis[4-(3-phenylphenyl)phenyl]-1-benzothiophen-5-amine.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-N,N-bis[4-(3-phenylphenyl)phenyl]-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 138488724 |
| Molecular Formula | C49H37NS |
| Molecular Weight | 671.91 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-N,N-bis[4-(3-phenylphenyl)phenyl]-1-benzothiophen-5-amine |
| SMILES | C=C/C=C\c1sc2ccc(N(c3ccc(-c4cccc(-c5ccccc5)c4)cc3)c3ccc(-c4cccc(-c5ccccc5)c4)cc3)cc2c1C |
| InChI | InChI=1S/C49H37NS/c1-3-4-21-48-35(2)47-34-46(30-31-49(47)51-48)50(44-26-22-38(23-27-44)42-19-11-17-40(32-42)36-13-7-5-8-14-36)45-28-24-39(25-29-45)43-20-12-18-41(33-43)37-15-9-6-10-16-37/h3-34H,1H2,2H3/b21-4- |
| InChIKey | YETMASCDHXDXBK-IGLQUIOVSA-N |
| XLogP | 14.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.91 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|