pentadecanoic acid

C15H30O2 — CID 13849

IUPACpentadecanoic acid
SMILESCCCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17)
InChIKeyWQEPLUUGTLDZJY-UHFFFAOYSA-N
MW242.40 g/mol
LogP5.16
Rot. Bonds13

About pentadecanoic acid

pentadecanoic acid (PubChem CID 13849) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is pentadecanoic acid.

Molecular Properties

Compound Namepentadecanoic acid
PubChem CID13849
Molecular FormulaC15H30O2
Molecular Weight242.40 g/mol
Exact Mass242.22
IUPAC Namepentadecanoic acid
SMILESCCCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17)
InChIKeyWQEPLUUGTLDZJY-UHFFFAOYSA-N
XLogP5.16
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms17
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500242.40
LogP ≤ 55.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze pentadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pentadecanoic acid?
The IUPAC name of pentadecanoic acid (CID 13849) is pentadecanoic acid.
What is the SMILES notation for pentadecanoic acid?
The canonical SMILES for pentadecanoic acid is CCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of pentadecanoic acid?
The InChIKey is WQEPLUUGTLDZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17).
What are the key properties of pentadecanoic acid?
pentadecanoic acid has a molecular weight of 242.40 g/mol, XLogP of 5.16, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecanoic acid is sourced from PubChem (CID 13849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).