C23H38FNO — CID 138493915
N-ethyl-3-[(7S)-2-[(1Z)-3-(fluoromethyl)-4-methylpenta-1,4-dienyl]-3-methyl-4,5,5a,6,7,8,9,9a-octahydro-1-benzoxepin-7-yl]propan-1-amine (PubChem CID 138493915) has the molecular formula C23H38FNO and a molecular weight of 363.56 g/mol. Its IUPAC name is N-ethyl-3-[(7S)-2-[(1Z)-3-(fluoromethyl)-4-methylpenta-1,4-dienyl]-3-methyl-4,5,5a,6,7,8,9,9a-octahydro-1-benzoxepin-7-yl]propan-1-amine.
| Compound Name | N-ethyl-3-[(7S)-2-[(1Z)-3-(fluoromethyl)-4-methylpenta-1,4-dienyl]-3-methyl-4,5,5a,6,7,8,9,9a-octahydro-1-benzoxepin-7-yl]propan-1-amine |
|---|---|
| PubChem CID | 138493915 |
| Molecular Formula | C23H38FNO |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | N-ethyl-3-[(7S)-2-[(1Z)-3-(fluoromethyl)-4-methylpenta-1,4-dienyl]-3-methyl-4,5,5a,6,7,8,9,9a-octahydro-1-benzoxepin-7-yl]propan-1-amine |
| SMILES | C=C(C)C(/C=C\C1=C(C)CCC2C[C@@H](CCCNCC)CCC2O1)CF |
| InChI | InChI=1S/C23H38FNO/c1-5-25-14-6-7-19-9-12-23-20(15-19)10-8-18(4)22(26-23)13-11-21(16-24)17(2)3/h11,13,19-21,23,25H,2,5-10,12,14-16H2,1,3-4H3/b13-11-/t19-,20?,21?,23?/m0/s1 |
| InChIKey | SFYJVLRYCYWSKU-WJLFAPIDSA-N |
| XLogP | 5.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|