C23H38FNO — CID 139459237
5-[(6E)-6-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4-dienoxy]nona-6,8-dienyl]-2-methylpiperidine (PubChem CID 139459237) has the molecular formula C23H38FNO and a molecular weight of 363.56 g/mol. Its IUPAC name is 5-[(6E)-6-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4-dienoxy]nona-6,8-dienyl]-2-methylpiperidine.
| Compound Name | 5-[(6E)-6-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4-dienoxy]nona-6,8-dienyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 139459237 |
| Molecular Formula | C23H38FNO |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | 5-[(6E)-6-[(2Z,4Z)-3-fluoro-2-methylhepta-2,4-dienoxy]nona-6,8-dienyl]-2-methylpiperidine |
| SMILES | C=C/C=C(\CCCCCC1CCC(C)NC1)OC/C(C)=C(F)/C=C\CC |
| InChI | InChI=1S/C23H38FNO/c1-5-7-14-23(24)19(3)18-26-22(11-6-2)13-10-8-9-12-21-16-15-20(4)25-17-21/h6-7,11,14,20-21,25H,2,5,8-10,12-13,15-18H2,1,3-4H3/b14-7-,22-11+,23-19- |
| InChIKey | GXMDOSVPRIGCRJ-PXTADJILSA-N |
| XLogP | 6.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|