C28H47NO2 — CID 144925486
(E)-2-[(Z)-3-(1-cyclohexylethenoxy)prop-1-enyl]-N-[6-[(3E)-hexa-1,3-dien-3-yl]oxyhexyl]pent-2-en-1-amine (PubChem CID 144925486) has the molecular formula C28H47NO2 and a molecular weight of 429.69 g/mol. Its IUPAC name is (E)-2-[(Z)-3-(1-cyclohexylethenoxy)prop-1-enyl]-N-[6-[(3E)-hexa-1,3-dien-3-yl]oxyhexyl]pent-2-en-1-amine.
| Compound Name | (E)-2-[(Z)-3-(1-cyclohexylethenoxy)prop-1-enyl]-N-[6-[(3E)-hexa-1,3-dien-3-yl]oxyhexyl]pent-2-en-1-amine |
|---|---|
| PubChem CID | 144925486 |
| Molecular Formula | C28H47NO2 |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | (E)-2-[(Z)-3-(1-cyclohexylethenoxy)prop-1-enyl]-N-[6-[(3E)-hexa-1,3-dien-3-yl]oxyhexyl]pent-2-en-1-amine |
| SMILES | C=C/C(=C\CC)OCCCCCCNCC(/C=C\COC(=C)C1CCCCC1)=C/CC |
| InChI | InChI=1S/C28H47NO2/c1-5-16-26(18-15-23-30-25(4)27-19-11-10-12-20-27)24-29-21-13-8-9-14-22-31-28(7-3)17-6-2/h7,15-18,27,29H,3-6,8-14,19-24H2,1-2H3/b18-15-,26-16+,28-17+ |
| InChIKey | MDVCSNYAYRTDNA-BINRYMQDSA-N |
| XLogP | 7.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|