methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate

C9H5BrINO3 — CID 138495449

IUPACmethyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate
SMILESCOC(=O)c1cc(Br)c2nc(I)oc2c1
InChIInChI=1S/C9H5BrINO3/c1-14-8(13)4-2-5(10)7-6(3-4)15-9(11)12-7/h2-3H,1H3
InChIKeyZMJJJZOIXGULJA-UHFFFAOYSA-N
MW381.95 g/mol
LogP2.98
Rot. Bonds1

About methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate

methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate (PubChem CID 138495449) has the molecular formula C9H5BrINO3 and a molecular weight of 381.95 g/mol. Its IUPAC name is methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate
PubChem CID138495449
Molecular FormulaC9H5BrINO3
Molecular Weight381.95 g/mol
Exact Mass380.85
IUPAC Namemethyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate
SMILESCOC(=O)c1cc(Br)c2nc(I)oc2c1
InChIInChI=1S/C9H5BrINO3/c1-14-8(13)4-2-5(10)7-6(3-4)15-9(11)12-7/h2-3H,1H3
InChIKeyZMJJJZOIXGULJA-UHFFFAOYSA-N
XLogP2.98
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500381.95
LogP ≤ 52.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate?
The IUPAC name of methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate (CID 138495449) is methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate.
What is the SMILES notation for methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate?
The canonical SMILES for methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate is COC(=O)c1cc(Br)c2nc(I)oc2c1.
What is the InChIKey of methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate?
The InChIKey is ZMJJJZOIXGULJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrINO3/c1-14-8(13)4-2-5(10)7-6(3-4)15-9(11)12-7/h2-3H,1H3.
What are the key properties of methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate?
methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate has a molecular weight of 381.95 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate is sourced from PubChem (CID 138495449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).