C9H5BrINO3 — CID 138495449
methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate (PubChem CID 138495449) has the molecular formula C9H5BrINO3 and a molecular weight of 381.95 g/mol. Its IUPAC name is methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate.
| Compound Name | methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 138495449 |
| Molecular Formula | C9H5BrINO3 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 380.85 |
| IUPAC Name | methyl 4-bromo-2-iodo-1,3-benzoxazole-6-carboxylate |
| SMILES | COC(=O)c1cc(Br)c2nc(I)oc2c1 |
| InChI | InChI=1S/C9H5BrINO3/c1-14-8(13)4-2-5(10)7-6(3-4)15-9(11)12-7/h2-3H,1H3 |
| InChIKey | ZMJJJZOIXGULJA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|