methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate

C12H13BrFNO3 — CID 177331102

IUPACmethyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate
SMILESCOC(=O)c1cc(Br)c(F)c(N2CCOCC2)c1
InChIInChI=1S/C12H13BrFNO3/c1-17-12(16)8-6-9(13)11(14)10(7-8)15-2-4-18-5-3-15/h6-7H,2-5H2,1H3
InChIKeyUOPMMTDIAKMSLS-UHFFFAOYSA-N
MW318.14 g/mol
LogP2.21
Rot. Bonds2

About methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate

methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate (PubChem CID 177331102) has the molecular formula C12H13BrFNO3 and a molecular weight of 318.14 g/mol. Its IUPAC name is methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate
PubChem CID177331102
Molecular FormulaC12H13BrFNO3
Molecular Weight318.14 g/mol
Exact Mass317.01
IUPAC Namemethyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate
SMILESCOC(=O)c1cc(Br)c(F)c(N2CCOCC2)c1
InChIInChI=1S/C12H13BrFNO3/c1-17-12(16)8-6-9(13)11(14)10(7-8)15-2-4-18-5-3-15/h6-7H,2-5H2,1H3
InChIKeyUOPMMTDIAKMSLS-UHFFFAOYSA-N
XLogP2.21
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.14
LogP ≤ 52.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate?
The IUPAC name of methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate (CID 177331102) is methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate.
What is the SMILES notation for methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate?
The canonical SMILES for methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate is COC(=O)c1cc(Br)c(F)c(N2CCOCC2)c1.
What is the InChIKey of methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate?
The InChIKey is UOPMMTDIAKMSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrFNO3/c1-17-12(16)8-6-9(13)11(14)10(7-8)15-2-4-18-5-3-15/h6-7H,2-5H2,1H3.
What are the key properties of methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate?
methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate has a molecular weight of 318.14 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-fluoro-5-morpholin-4-ylbenzoate is sourced from PubChem (CID 177331102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).