C14H25NO7 — CID 138497393
(Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propoxy]-4-oxobut-2-enoic acid (PubChem CID 138497393) has the molecular formula C14H25NO7 and a molecular weight of 319.35 g/mol. Its IUPAC name is (Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 138497393 |
| Molecular Formula | C14H25NO7 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propoxy]-4-oxobut-2-enoic acid |
| SMILES | NCCCOCCOCCOCCCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H25NO7/c15-5-1-6-19-9-11-21-12-10-20-7-2-8-22-14(18)4-3-13(16)17/h3-4H,1-2,5-12,15H2,(H,16,17)/b4-3- |
| InChIKey | VJBZWSOJCHFZTF-ARJAWSKDSA-N |
| XLogP | -0.04 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|