C14H26N2O7 — CID 118402520
(Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]oxy-4-oxobut-2-enoic acid (PubChem CID 118402520) has the molecular formula C14H26N2O7 and a molecular weight of 334.37 g/mol. Its IUPAC name is (Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]oxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 118402520 |
| Molecular Formula | C14H26N2O7 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (Z)-4-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propylamino]oxy-4-oxobut-2-enoic acid |
| SMILES | NCCCOCCOCCOCCCNOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H26N2O7/c15-5-1-7-20-9-11-22-12-10-21-8-2-6-16-23-14(19)4-3-13(17)18/h3-4,16H,1-2,5-12,15H2,(H,17,18)/b4-3- |
| InChIKey | VILZJTCOYNCFRK-ARJAWSKDSA-N |
| XLogP | -0.54 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|