C14H30N2O7+2 — CID 142314539
3-[2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy]propylazanium;(Z)-but-2-enedioic acid (PubChem CID 142314539) has the molecular formula C14H30N2O7+2 and a molecular weight of 338.40 g/mol. Its IUPAC name is 3-[2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy]propylazanium;(Z)-but-2-enedioic acid.
| Compound Name | 3-[2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy]propylazanium;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 142314539 |
| Molecular Formula | C14H30N2O7+2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-[2-[2-(3-azaniumylpropoxy)ethoxy]ethoxy]propylazanium;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.[NH3+]CCCOCCOCCOCCC[NH3+] |
| InChI | InChI=1S/C10H24N2O3.C4H4O4/c11-3-1-5-13-7-9-15-10-8-14-6-2-4-12;5-3(6)1-2-4(7)8/h1-12H2;1-2H,(H,5,6)(H,7,8)/p+2/b;2-1- |
| InChIKey | AHCLXVDSJKEGCO-BTJKTKAUSA-P |
| XLogP | -1.99 |
| TPSA | 157.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|