C16H11F6NOS — CID 138498242
N-cyclopropyl-3-fluoro-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)sulfanylaniline (PubChem CID 138498242) has the molecular formula C16H11F6NOS and a molecular weight of 379.33 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)sulfanylaniline.
| Compound Name | N-cyclopropyl-3-fluoro-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)sulfanylaniline |
|---|---|
| PubChem CID | 138498242 |
| Molecular Formula | C16H11F6NOS |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-cyclopropyl-3-fluoro-4-methoxy-N-(2,3,4,5,6-pentafluorophenyl)sulfanylaniline |
| SMILES | COc1ccc(N(Sc2c(F)c(F)c(F)c(F)c2F)C2CC2)cc1F |
| InChI | InChI=1S/C16H11F6NOS/c1-24-10-5-4-8(6-9(10)17)23(7-2-3-7)25-16-14(21)12(19)11(18)13(20)15(16)22/h4-7H,2-3H2,1H3 |
| InChIKey | BOANTNDRVHHKCZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|