C19H19N3O7S — CID 138500548
ethyl 2-[[2-[2-(2,3-dioxoindol-1-yl)-1-hydroxyethoxy]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 138500548) has the molecular formula C19H19N3O7S and a molecular weight of 433.44 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(2,3-dioxoindol-1-yl)-1-hydroxyethoxy]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(2,3-dioxoindol-1-yl)-1-hydroxyethoxy]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 138500548 |
| Molecular Formula | C19H19N3O7S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | ethyl 2-[[2-[2-(2,3-dioxoindol-1-yl)-1-hydroxyethoxy]acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(O)CN2C(=O)C(=O)c3ccccc32)nc1C |
| InChI | InChI=1S/C19H19N3O7S/c1-3-28-18(27)16-10(2)20-19(30-16)21-13(23)9-29-14(24)8-22-12-7-5-4-6-11(12)15(25)17(22)26/h4-7,14,24H,3,8-9H2,1-2H3,(H,20,21,23) |
| InChIKey | DMCNOQGGOJNTTR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|