C18H23N3O — CID 138502235
(1E)-N-anilino-2-cyclononyl-2-oxoethanimidoyl cyanide (PubChem CID 138502235) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is (1E)-N-anilino-2-cyclononyl-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-N-anilino-2-cyclononyl-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 138502235 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (1E)-N-anilino-2-cyclononyl-2-oxoethanimidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccccc1)C(=O)C1CCCCCCCC1 |
| InChI | InChI=1S/C18H23N3O/c19-14-17(21-20-16-12-8-5-9-13-16)18(22)15-10-6-3-1-2-4-7-11-15/h5,8-9,12-13,15,20H,1-4,6-7,10-11H2/b21-17+ |
| InChIKey | OVBPPVOPLCXIIQ-HEHNFIMWSA-N |
| XLogP | 4.30 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|