C12H9F2N3O — CID 53257745
(1E)-2-cyclopropyl-N-(3,4-difluoroanilino)-2-oxoethanimidoyl cyanide (PubChem CID 53257745) has the molecular formula C12H9F2N3O and a molecular weight of 249.22 g/mol. Its IUPAC name is (1E)-2-cyclopropyl-N-(3,4-difluoroanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-cyclopropyl-N-(3,4-difluoroanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 53257745 |
| Molecular Formula | C12H9F2N3O |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (1E)-2-cyclopropyl-N-(3,4-difluoroanilino)-2-oxoethanimidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccc(F)c(F)c1)C(=O)C1CC1 |
| InChI | InChI=1S/C12H9F2N3O/c13-9-4-3-8(5-10(9)14)16-17-11(6-15)12(18)7-1-2-7/h3-5,7,16H,1-2H2/b17-11+ |
| InChIKey | FCEOFYMEAPSUPH-GZTJUZNOSA-N |
| XLogP | 2.24 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|