C11H10F2N2O4 — CID 23118461
dimethyl 2-[(3,4-difluorophenyl)hydrazinylidene]propanedioate (PubChem CID 23118461) has the molecular formula C11H10F2N2O4 and a molecular weight of 272.21 g/mol. Its IUPAC name is dimethyl 2-[(3,4-difluorophenyl)hydrazinylidene]propanedioate.
| Compound Name | dimethyl 2-[(3,4-difluorophenyl)hydrazinylidene]propanedioate |
|---|---|
| PubChem CID | 23118461 |
| Molecular Formula | C11H10F2N2O4 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | dimethyl 2-[(3,4-difluorophenyl)hydrazinylidene]propanedioate |
| SMILES | COC(=O)C(=NNc1ccc(F)c(F)c1)C(=O)OC |
| InChI | InChI=1S/C11H10F2N2O4/c1-18-10(16)9(11(17)19-2)15-14-6-3-4-7(12)8(13)5-6/h3-5,14H,1-2H3 |
| InChIKey | GBWUGNYHVFGMFC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|