C20H24F2N2O2S — CID 138506849
N-(3,3-difluoro-1-hydroxybutan-2-yl)-6-methyl-11-thia-6-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-4-carboxamide (PubChem CID 138506849) has the molecular formula C20H24F2N2O2S and a molecular weight of 394.49 g/mol. Its IUPAC name is N-(3,3-difluoro-1-hydroxybutan-2-yl)-6-methyl-11-thia-6-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-4-carboxamide.
| Compound Name | N-(3,3-difluoro-1-hydroxybutan-2-yl)-6-methyl-11-thia-6-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 138506849 |
| Molecular Formula | C20H24F2N2O2S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(3,3-difluoro-1-hydroxybutan-2-yl)-6-methyl-11-thia-6-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraene-4-carboxamide |
| SMILES | CN1CC(C(=O)NC(CO)C(C)(F)F)CC2c3cccc4scc(c34)CC21 |
| InChI | InChI=1S/C20H24F2N2O2S/c1-20(21,22)17(9-25)23-19(26)11-6-14-13-4-3-5-16-18(13)12(10-27-16)7-15(14)24(2)8-11/h3-5,10-11,14-15,17,25H,6-9H2,1-2H3,(H,23,26) |
| InChIKey | NJUDWYFZTCNARL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |