C22H30FN3O2 — CID 90251370
(6aR,9R)-4-(fluoromethyl)-N-[(2S)-1-hydroxybutan-2-yl]-5,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 90251370) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is (6aR,9R)-4-(fluoromethyl)-N-[(2S)-1-hydroxybutan-2-yl]-5,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-4-(fluoromethyl)-N-[(2S)-1-hydroxybutan-2-yl]-5,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 90251370 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | (6aR,9R)-4-(fluoromethyl)-N-[(2S)-1-hydroxybutan-2-yl]-5,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)[C@@H]1CC2c3cccc4c3c(c(C)n4CF)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C22H30FN3O2/c1-4-15(11-27)24-22(28)14-8-18-16-6-5-7-19-21(16)17(13(2)26(19)12-23)9-20(18)25(3)10-14/h5-7,14-15,18,20,27H,4,8-12H2,1-3H3,(H,24,28)/t14-,15+,18?,20-/m1/s1 |
| InChIKey | AGJQQOLKYHHOIU-JBLULZNDSA-N |
| XLogP | 2.72 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|