C23H23NO4 — CID 138507979
3-hydroxy-5-methoxy-2-[(E)-3-(4-methylphenyl)prop-2-enoyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzaldehyde (PubChem CID 138507979) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-hydroxy-5-methoxy-2-[(E)-3-(4-methylphenyl)prop-2-enoyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzaldehyde.
| Compound Name | 3-hydroxy-5-methoxy-2-[(E)-3-(4-methylphenyl)prop-2-enoyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 138507979 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-hydroxy-5-methoxy-2-[(E)-3-(4-methylphenyl)prop-2-enoyl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzaldehyde |
| SMILES | COc1cc(C=O)c(C(=O)/C=C/c2ccc(C)cc2)c(O)c1C1=CCNCC1 |
| InChI | InChI=1S/C23H23NO4/c1-15-3-5-16(6-4-15)7-8-19(26)21-18(14-25)13-20(28-2)22(23(21)27)17-9-11-24-12-10-17/h3-9,13-14,24,27H,10-12H2,1-2H3/b8-7+ |
| InChIKey | RBNGMSPWFBIUDS-BQYQJAHWSA-N |
| XLogP | 3.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|