C12H26N2S — CID 138509343
1-(2-butylsulfanyl-1-methylpyrrolidin-3-yl)-N,N-dimethylmethanamine (PubChem CID 138509343) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 1-(2-butylsulfanyl-1-methylpyrrolidin-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-butylsulfanyl-1-methylpyrrolidin-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 138509343 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(2-butylsulfanyl-1-methylpyrrolidin-3-yl)-N,N-dimethylmethanamine |
| SMILES | CCCCSC1C(CN(C)C)CCN1C |
| InChI | InChI=1S/C12H26N2S/c1-5-6-9-15-12-11(10-13(2)3)7-8-14(12)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | SWFFKMQLDWUZQW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|