C17H20N2O4 — CID 138510118
1-(2-hydroxy-2-phenylethyl)-3,5-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 138510118) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(2-hydroxy-2-phenylethyl)-3,5-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-hydroxy-2-phenylethyl)-3,5-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138510118 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(2-hydroxy-2-phenylethyl)-3,5-dimethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(C)C(=O)N(C)C(=O)N(CC(O)c2ccccc2)C1=O |
| InChI | InChI=1S/C17H20N2O4/c1-4-10-17(2)14(21)18(3)16(23)19(15(17)22)11-13(20)12-8-6-5-7-9-12/h4-9,13,20H,1,10-11H2,2-3H3 |
| InChIKey | CMCHFPXCNLORIS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|