C19H22N2O4 — CID 90358570
1,5-dimethyl-5-(3-methylbut-2-enyl)-3-phenacyl-1,3-diazinane-2,4,6-trione (PubChem CID 90358570) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1,5-dimethyl-5-(3-methylbut-2-enyl)-3-phenacyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,5-dimethyl-5-(3-methylbut-2-enyl)-3-phenacyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90358570 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1,5-dimethyl-5-(3-methylbut-2-enyl)-3-phenacyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)=CCC1(C)C(=O)N(C)C(=O)N(CC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C19H22N2O4/c1-13(2)10-11-19(3)16(23)20(4)18(25)21(17(19)24)12-15(22)14-8-6-5-7-9-14/h5-10H,11-12H2,1-4H3 |
| InChIKey | VADFEAYRWMGMIG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|