C19H16BrClN2O — CID 138511067
2-[1-[(1S)-4-bromo-1-methyl-1,3-dihydroisoindol-2-yl]-3-oxopropan-2-yl]-3-chlorobenzonitrile (PubChem CID 138511067) has the molecular formula C19H16BrClN2O and a molecular weight of 403.71 g/mol. Its IUPAC name is 2-[1-[(1S)-4-bromo-1-methyl-1,3-dihydroisoindol-2-yl]-3-oxopropan-2-yl]-3-chlorobenzonitrile.
| Compound Name | 2-[1-[(1S)-4-bromo-1-methyl-1,3-dihydroisoindol-2-yl]-3-oxopropan-2-yl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 138511067 |
| Molecular Formula | C19H16BrClN2O |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-[1-[(1S)-4-bromo-1-methyl-1,3-dihydroisoindol-2-yl]-3-oxopropan-2-yl]-3-chlorobenzonitrile |
| SMILES | C[C@H]1c2cccc(Br)c2CN1CC(C=O)c1c(Cl)cccc1C#N |
| InChI | InChI=1S/C19H16BrClN2O/c1-12-15-5-3-6-17(20)16(15)10-23(12)9-14(11-24)19-13(8-22)4-2-7-18(19)21/h2-7,11-12,14H,9-10H2,1H3/t12-,14?/m0/s1 |
| InChIKey | QFSPHIBTSQQVDJ-NBFOIZRFSA-N |
| XLogP | 4.83 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|