C30H33FN8O5 — CID 138514434
2-[(3R,4S)-1-(2,3-dihydroxypropanoyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 138514434) has the molecular formula C30H33FN8O5 and a molecular weight of 604.64 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(2,3-dihydroxypropanoyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-1-(2,3-dihydroxypropanoyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 138514434 |
| Molecular Formula | C30H33FN8O5 |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 2-[(3R,4S)-1-(2,3-dihydroxypropanoyl)-3-fluoropiperidin-4-yl]oxy-5-[4-[4-[(2R)-1,4-dimethyl-3-oxopiperazin-2-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CN1CCN(C)[C@H](c2ccc(Nc3ncnc(-c4ccc(O[C@H]5CCN(C(=O)C(O)CO)C[C@H]5F)c(C#N)c4)n3)cc2)C1=O |
| InChI | InChI=1S/C30H33FN8O5/c1-37-11-12-38(2)29(43)26(37)18-3-6-21(7-4-18)35-30-34-17-33-27(36-30)19-5-8-24(20(13-19)14-32)44-25-9-10-39(15-22(25)31)28(42)23(41)16-40/h3-8,13,17,22-23,25-26,40-41H,9-12,15-16H2,1-2H3,(H,33,34,35,36)/t22-,23?,25+,26-/m1/s1 |
| InChIKey | ZCOPUBNAQOSSHH-OJYYSWAESA-N |
| XLogP | 1.27 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |